Information card for entry 2017981
| Common name |
3,13,23-triazahexacyclo[14.7.0.0^2,10^.0^4,9^.0^11,15^.0^17,22^]tricosa- 1(16),2(10),4,6,8,11(15),17(22),18,20-nonaene-12,14-dione |
| Chemical name |
12,13-Dihydro-5<i>H</i>-indolo[2,3-<i>a</i>]pyrrolo[3,4-<i>c</i>]carbazole- 5,7(6<i>H</i>)-dione monohydrate |
| Formula |
C20 H13 N3 O3 |
| Calculated formula |
C20 H13 N3 O3 |
| SMILES |
[nH]1c2ccccc2c2c1c1[nH]c3c(c1c1c2c(=O)[nH]c1=O)cccc3.O |
| Title of publication |
Arcyriaflavin A monohydrate |
| Authors of publication |
Fernandes, José A.; Almeida Paz, Filipe A.; Marques, Joana; Marques, Maria P. M.; Braga, Susana S. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
2 |
| Pages of publication |
o57 - o59 |
| a |
4.7347 ± 0.0001 Å |
| b |
18.1877 ± 0.0007 Å |
| c |
18.1068 ± 0.0006 Å |
| α |
90° |
| β |
93.594 ± 0.002° |
| γ |
90° |
| Cell volume |
1556.17 ± 0.09 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1123 |
| Residual factor for significantly intense reflections |
0.0529 |
| Weighted residual factors for significantly intense reflections |
0.1186 |
| Weighted residual factors for all reflections included in the refinement |
0.1405 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.004 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2017981.html