Information card for entry 2018193
| Chemical name |
2,2'-(ethane-1,2-diyl)bis[2-(5-bromothiophen-2-yl)-1,3-dioxolane] |
| Formula |
C16 H16 Br2 O4 S2 |
| Calculated formula |
C16 H16 Br2 O4 S2 |
| SMILES |
Brc1ccc(s1)C1(CCC2(OCCO2)c2ccc(s2)Br)OCCO1 |
| Title of publication |
2,2'-(Ethane-1,2-diyl)bis[2-(5-bromothiophen-2-yl)-1,3-dioxolane] at 100K refined using a multipolar atom model |
| Authors of publication |
Ahmed, Maqsood; Noureen, Sajida; Gros, Philippe C.; Guillot, Benoit; Jelsch, Christian |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
8 |
| Pages of publication |
o329 - o333 |
| a |
19.255 ± 0.001 Å |
| b |
5.7804 ± 0.0004 Å |
| c |
16.9328 ± 0.0006 Å |
| α |
90° |
| β |
112.845 ± 0.004° |
| γ |
90° |
| Cell volume |
1736.81 ± 0.17 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0219 |
| Residual factor for significantly intense reflections |
0.0212 |
| Weighted residual factors for significantly intense reflections |
0.0521 |
| Weighted residual factors for all reflections included in the refinement |
0.0527 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2018193.html