Information card for entry 2018215
| Common name |
2,5-dimethoxyterephthalic acid |
| Chemical name |
2,5-dimethoxyterephthalic acid |
| Formula |
C10 H10 O6 |
| Calculated formula |
C10 H10 O6 |
| SMILES |
COc1cc(C(=O)O)c(cc1C(=O)O)OC |
| Title of publication |
Little change but great effect: varying supramolecular interactions in 2,5-dimethoxyterephthalic acid and 2,5-diethoxyterephthalic acid |
| Authors of publication |
Böhle, Tony; Eissmann, Frank; Seichter, Wilhelm; Weber, Edwin; Mertens, Florian O. R. L. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
9 |
| Pages of publication |
o350 - o353 |
| a |
11.6424 ± 0.0003 Å |
| b |
10.7368 ± 0.0003 Å |
| c |
7.6554 ± 0.0002 Å |
| α |
90° |
| β |
93.804 ± 0.002° |
| γ |
90° |
| Cell volume |
954.83 ± 0.04 Å3 |
| Cell temperature |
153 ± 2 K |
| Ambient diffraction temperature |
153 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0334 |
| Residual factor for significantly intense reflections |
0.0293 |
| Weighted residual factors for significantly intense reflections |
0.0821 |
| Weighted residual factors for all reflections included in the refinement |
0.0841 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.096 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2018215.html