Information card for entry 2018245
| Chemical name |
(2<i>RS</i>,3<i>RS</i>)-5-amino-3-(4-phenylpiperazin-1-yl)-1,2,3,4- tetrahydronaphthalen-2-ol |
| Formula |
C20 H25 N3 O |
| Calculated formula |
C20 H25 N3 O |
| SMILES |
c1ccccc1N1CCN(CC1)[C@@H]1[C@H](Cc2c(C1)c(ccc2)N)O.c1ccccc1N1CCN(CC1)[C@H]1[C@@H](Cc2c(C1)c(ccc2)N)O |
| Title of publication |
Powder X-ray study of racemic (2<i>RS</i>,3<i>RS</i>)-5-amino-3-(4-phenylpiperazin-1-yl)-1,2,3,4-tetrahydronaphthalen-2-ol |
| Authors of publication |
Assaad, Thaer; Rukiah, Mwaffak |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
10 |
| Pages of publication |
o378 - o381 |
| a |
11.4132 ± 0.0004 Å |
| b |
8.8555 ± 0.0003 Å |
| c |
17.1797 ± 0.0004 Å |
| α |
90° |
| β |
90.5787 ± 0.0017° |
| γ |
90° |
| Cell volume |
1736.26 ± 0.09 Å3 |
| Cell temperature |
298 K |
| Ambient diffraction temperature |
298 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Goodness-of-fit parameter for all reflections |
1.37 |
| Method of determination |
powder diffraction |
| Diffraction radiation wavelength |
1.5406 Å |
| Diffraction radiation type |
CuKα~1~ |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2018245.html