Information card for entry 2018457
| Chemical name |
4,4'-(4,5-Dimethyl-1,2-phenylene)bis(2-methylbut-3-yn-2-ol) |
| Formula |
C18 H22 O2 |
| Calculated formula |
C18 H22 O2 |
| SMILES |
CC(C#Cc1cc(C)c(cc1C#CC(O)(C)C)C)(O)C |
| Title of publication |
4,4'-(4,5-Dimethyl-1,2-phenylene)bis(2-methylbut-3-yn-2-ol): structural variation in vicinal dialkynols |
| Authors of publication |
Bond, Marcus R.; Hathaway, Bruce A.; Kilgore, Uriah J. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
4 |
| Pages of publication |
o179 - o182 |
| a |
8.472 ± 0.0001 Å |
| b |
22.7966 ± 0.0003 Å |
| c |
16.8592 ± 0.0002 Å |
| α |
90° |
| β |
93.886 ± 0.001° |
| γ |
90° |
| Cell volume |
3248.58 ± 0.07 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0677 |
| Residual factor for significantly intense reflections |
0.0456 |
| Weighted residual factors for significantly intense reflections |
0.1102 |
| Weighted residual factors for all reflections included in the refinement |
0.1223 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.012 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2018457.html