Information card for entry 2018492
| Chemical name |
(3<i>R</i>,5<i>S</i>,5'<i>R</i>,8<i>R</i>,9<i>S</i>,10<i>S</i>,13<i>S</i>, 14<i>S</i>)-10,13-dimethyl-5'-(2-methylpropyl)tetradecahydro-6'<i>H</i>- spiro[cyclopenta[<i>a</i>]phenanthrene-3,2'-[1,4]oxazinane]-6',17(2<i>H</i>)- dione |
| Formula |
C26 H41 N O3 |
| Calculated formula |
C26 H41 N O3 |
| SMILES |
O1[C@@]2(CC[C@]3([C@H](C2)CC[C@@H]2[C@@H]3CC[C@]3([C@H]2CCC3=O)C)C)CN[C@@H](C1=O)CC(C)C |
| Title of publication |
Two androsterone derivatives as inhibitors of androgen biosynthesis |
| Authors of publication |
Djigoue, Guy-Bertrand; Simard, Michel; Kenmogne, Lucie-Carolle; Poirier, Donald |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
6 |
| Pages of publication |
o231 - o234 |
| a |
13.07929 ± 0.00017 Å |
| b |
5.82873 ± 0.00008 Å |
| c |
16.314 ± 0.0002 Å |
| α |
90° |
| β |
107.31 ± 0.0006° |
| γ |
90° |
| Cell volume |
1187.38 ± 0.03 Å3 |
| Cell temperature |
150 K |
| Ambient diffraction temperature |
150 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0415 |
| Residual factor for significantly intense reflections |
0.0402 |
| Weighted residual factors for significantly intense reflections |
0.1058 |
| Weighted residual factors for all reflections included in the refinement |
0.1071 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.069 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2018492.html