Information card for entry 2018612
| Chemical name |
1-<i>n</i>-Butylindeno[2,1-<i>c</i>]pyran-3,9-dione |
| Formula |
C16 H14 O3 |
| Calculated formula |
C16 H14 O3 |
| SMILES |
CCCCc1oc(=O)cc2c1C(=O)c1c2cccc1 |
| Title of publication |
An irreversible phase transition in 1-<i>n</i>-butylindeno[2,1-<i>c</i>]pyran-3,9-dione |
| Authors of publication |
Batsanov, Andrei S.; Howard, Judith A. K.; Wu, Na; Yang, Zhen; Marder, Todd B. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
10 |
| Pages of publication |
o413 - o416 |
| a |
5.3708 ± 0.0002 Å |
| b |
7.2029 ± 0.0003 Å |
| c |
16.9507 ± 0.0008 Å |
| α |
96.461 ± 0.002° |
| β |
93.246 ± 0.002° |
| γ |
110.029 ± 0.002° |
| Cell volume |
608.98 ± 0.05 Å3 |
| Cell temperature |
120 K |
| Ambient diffraction temperature |
120 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0627 |
| Residual factor for significantly intense reflections |
0.037 |
| Weighted residual factors for significantly intense reflections |
0.0827 |
| Weighted residual factors for all reflections included in the refinement |
0.0911 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.959 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2018612.html