Information card for entry 2019086
| Chemical name |
Methyl (1<i>RS</i>,3<i>SR</i>,3a<i>RS</i>,6a<i>SR</i>)-1-methyl-3-(3-methyl-1-phenyl-1<i>H</i>-pyrazol-4-yl)-4,6-dioxo-5-phenyloctahydropyrrolo[3,4-<i>c</i>]pyrrole-1-carboxylate |
| Formula |
C25 H24 N4 O4 |
| Calculated formula |
C25 H24 N4 O4 |
| SMILES |
[C@@]1(N[C@@H]([C@@H]2C(=O)N(C(=O)[C@H]12)c1ccccc1)c1c(nn(c1)c1ccccc1)C)(C(=O)OC)C.[C@]1(N[C@H]([C@H]2C(=O)N(C(=O)[C@@H]12)c1ccccc1)c1c(nn(c1)c1ccccc1)C)(C(=O)OC)C |
| Title of publication |
Two methyl 3-(1<i>H</i>-pyrazol-4-yl)octahydropyrrolo[3,4-<i>c</i>]pyrrole-1-carboxylates form different hydrogen-bonded sheets |
| Authors of publication |
Quiroga, Jairo; Gálvez, Jaime; Cobo, Justo; Glidewell, Christopher |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
8 |
| Pages of publication |
915 - 919 |
| a |
11.355 ± 0.002 Å |
| b |
20.025 ± 0.004 Å |
| c |
10.4124 ± 0.0008 Å |
| α |
90° |
| β |
110.03 ± 0.009° |
| γ |
90° |
| Cell volume |
2224.4 ± 0.6 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.09 |
| Residual factor for significantly intense reflections |
0.0502 |
| Weighted residual factors for significantly intense reflections |
0.1134 |
| Weighted residual factors for all reflections included in the refinement |
0.136 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.063 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2019086.html