Information card for entry 2020278
| Chemical name |
1''-Acetyl-1-benzyl-4',5'-diphenyl-4',5'-dihydrodispiro[indoline-3,2'-furan-3',3''-indoline]-2,2''-dione |
| Formula |
C39 H30 N2 O4 |
| Calculated formula |
C39 H30 N2 O4 |
| SMILES |
c12ccccc1[C@]1(C(=O)N2Cc2ccccc2)[C@]2([C@H]([C@H](c3ccccc3)O1)c1ccccc1)c1ccccc1N(C2=O)C(=O)C.c12ccccc1[C@@]1(C(=O)N2Cc2ccccc2)[C@@]2([C@@H]([C@@H](c3ccccc3)O1)c1ccccc1)c1ccccc1N(C2=O)C(=O)C |
| Title of publication |
Structural consequences of weak interactions in dispirooxindole derivatives |
| Authors of publication |
Ravikumar, Krishnan; Sridhar, Balasubramanian; Nanubolu, Jagadeesh Babu; Karthik, Govindaraju; Reddy, Basi Venkata Subba |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2015 |
| Journal volume |
71 |
| Journal issue |
11 |
| a |
9.7565 ± 0.001 Å |
| b |
16.6868 ± 0.0016 Å |
| c |
19.9593 ± 0.0019 Å |
| α |
71.653 ± 0.002° |
| β |
81.657 ± 0.002° |
| γ |
89.314 ± 0.002° |
| Cell volume |
3049.7 ± 0.5 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.113 |
| Residual factor for significantly intense reflections |
0.0698 |
| Weighted residual factors for significantly intense reflections |
0.1322 |
| Weighted residual factors for all reflections included in the refinement |
0.1489 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.093 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2020278.html