Information card for entry 2020614
| Chemical name |
Tetraphenylphosphonium tris(thiocyanato-κ<i>N</i>)[1,1,1-tris(pyridin-2-yl)ethane-κ^3^<i>N</i>,<i>N</i>',<i>N</i>'']ferrate(II) |
| Formula |
C44 H35 Fe N6 P S3 |
| Calculated formula |
C44 H35 Fe N6 P S3 |
| SMILES |
[Fe]12([n]3c(C(c4[n]1cccc4)(c1[n]2cccc1)C)cccc3)(N=C=S)(N=C=S)N=C=S.[P+](c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| Title of publication |
An iron(II) complex tripodally chelated with 1,1,1-tris(pyridin-2-yl)ethane showing room-temperature spin-crossover behaviour |
| Authors of publication |
Ishida, Takayuki; Kanetomo, Takuya; Yamasaki, Masaru |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2016 |
| Journal volume |
72 |
| Journal issue |
11 |
| Pages of publication |
797 - 801 |
| a |
8.956 ± 0.0011 Å |
| b |
15.7745 ± 0.0016 Å |
| c |
28.455 ± 0.003 Å |
| α |
90° |
| β |
94.067 ± 0.003° |
| γ |
90° |
| Cell volume |
4009.9 ± 0.8 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0748 |
| Residual factor for significantly intense reflections |
0.0566 |
| Weighted residual factors for significantly intense reflections |
0.1441 |
| Weighted residual factors for all reflections included in the refinement |
0.1583 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.08 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2020614.html