Information card for entry 2020833
| Chemical name |
Tricarbonyl[(1',2',3',4',5',6'-η)-2-fluoro-1,1'-biphenyl]chromium(0) |
| Formula |
C15 H9 Cr F O3 |
| Calculated formula |
C15 H9 Cr F O3 |
| SMILES |
[Cr]12345([c]6([cH]1[cH]2[cH]3[cH]4[cH]56)c1c(F)cccc1)(C#[O])(C#[O])C#[O] |
| Title of publication |
Intricacies of ligand coordination in tricarbonylchromium(0) complexes with <i>ortho</i>- and <i>para</i>-fluorobiphenyls |
| Authors of publication |
Guzei, Ilia A.; Spencer, Lara C.; Buechel, Sondra C.; Kaufmann, Leah B.; Czerwinski, Curtis J. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2017 |
| Journal volume |
73 |
| Journal issue |
8 |
| a |
7.0166 ± 0.0003 Å |
| b |
27.4725 ± 0.0011 Å |
| c |
7.1101 ± 0.0003 Å |
| α |
90° |
| β |
113.738 ± 0.001° |
| γ |
90° |
| Cell volume |
1254.61 ± 0.09 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100.15 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0258 |
| Residual factor for significantly intense reflections |
0.024 |
| Weighted residual factors for significantly intense reflections |
0.0666 |
| Weighted residual factors for all reflections included in the refinement |
0.0682 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.074 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2020833.html