Information card for entry 2020839
| Chemical name |
[(1-{4-[2-(2,4-Dihydroxyphenyl)diazen-1-yl]phenyl}ethylidene)amino]thiourea 1,1,2,2-tetrachloroethane monosolvate |
| Formula |
C17 H17 Cl4 N5 O2 S |
| Calculated formula |
C17 H17 Cl4 N5 O2 S |
| SMILES |
O=c1c(ccc(O)c1)=NNc1ccc(cc1)C(=N\NC(=S)N)\C.C(C(Cl)Cl)(Cl)Cl |
| Title of publication |
Crystal structure of a 1,1,2,2-tetrachloroethane-solvated hydrazinecarbothioamide compound |
| Authors of publication |
Riyadh, Sayed; Hughes, David L.; Said, Musa A. |
| Journal of publication |
Acta Crystallographica Section E Crystallographic Communications |
| Year of publication |
2017 |
| Journal volume |
73 |
| Journal issue |
9 |
| Pages of publication |
1271 |
| a |
5.9124 ± 0.0002 Å |
| b |
17.6155 ± 0.0005 Å |
| c |
20.3351 ± 0.0006 Å |
| α |
90° |
| β |
96.563 ± 0.003° |
| γ |
90° |
| Cell volume |
2104.02 ± 0.11 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 1 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0865 |
| Residual factor for significantly intense reflections |
0.0764 |
| Weighted residual factors for significantly intense reflections |
0.1967 |
| Weighted residual factors for all reflections included in the refinement |
0.2035 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.087 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
Mo-Kα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2020839.html