Information card for entry 2020864
| Chemical name |
bis(1,2,3-trimethylpyridnium) tetrabromidocuprate(II) |
| Formula |
C16 H24 Br4 Cu N2 |
| Calculated formula |
C16 H24 Br4 Cu N2 |
| SMILES |
Br[Cu](Br)([Br-])[Br-].[n+]1(c(c(ccc1)C)C)C.[n+]1(c(c(ccc1)C)C)C |
| Title of publication |
The square-planar to flattened-tetrahedral CuX42−(X= Cl, Br) structural phase transition in 1,2,6-trimethylpyridinium salts |
| Authors of publication |
Kelley, Annette; Nalla, Sowjanya; Bond, Marcus R. |
| Journal of publication |
Acta Crystallographica Section B Structural Science, Crystal Engineering and Materials |
| Year of publication |
2015 |
| Journal volume |
71 |
| Journal issue |
1 |
| Pages of publication |
48 - 60 |
| a |
17.6373 ± 0.0005 Å |
| b |
9.4076 ± 0.0004 Å |
| c |
14.7798 ± 0.0005 Å |
| α |
90° |
| β |
118.396 ± 0.002° |
| γ |
90° |
| Cell volume |
2157.27 ± 0.14 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0544 |
| Residual factor for significantly intense reflections |
0.028 |
| Weighted residual factors for significantly intense reflections |
0.0593 |
| Weighted residual factors for all reflections included in the refinement |
0.0645 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.948 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2020864.html