Information card for entry 2021805
| Chemical name |
3-[5-(Pyridin-4-yl)-1,3,4-oxadiazol-2-yl]-2<i>H</i>-chromen-2-one |
| Formula |
C16 H9 N3 O3 |
| Calculated formula |
C16 H9 N3 O3 |
| SMILES |
o1c2ccccc2cc(c1=O)c1oc(nn1)c1ccncc1 |
| Title of publication |
Polymorphism of 3-(5-phenyl-1,3,4-oxadiazol-2-yl)- and 3-[5-(pyridin-4-yl)-1,3,4-oxadiazol-2-yl]-2<i>H</i>-chromen-2-ones |
| Authors of publication |
Shishkina, Svitlana V.; Konovalova, Irina S.; Trostianko, Pavlo V.; Geleverya, Anna O.; Kovalenko, Sergiy M.; Bunyatyan, Natalya D. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2019 |
| Journal volume |
75 |
| Journal issue |
11 |
| a |
20.931 ± 0.002 Å |
| b |
3.7708 ± 0.0005 Å |
| c |
16.0887 ± 0.0015 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1269.8 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
29 |
| Hermann-Mauguin space group symbol |
P c a 21 |
| Hall space group symbol |
P 2c -2ac |
| Residual factor for all reflections |
0.0803 |
| Residual factor for significantly intense reflections |
0.0566 |
| Weighted residual factors for significantly intense reflections |
0.1203 |
| Weighted residual factors for all reflections included in the refinement |
0.1326 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.957 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2021805.html