Information card for entry 2022207
| Chemical name |
Methyl 4-(4-fluorophenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Formula |
C13 H13 F N2 O3 |
| Calculated formula |
C13 H13 F N2 O3 |
| SMILES |
O=C(OC)C1=C(NC(=O)NC1c1ccc(F)cc1)C |
| Title of publication |
Crystal structures of the anhydrous and two solvated forms of methyl 4-(4-fluorophenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Authors of publication |
Cleetus, Annie; Rani, Gulshan; Dharma Rao, G. B.; Chopra, Deepak |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2020 |
| Journal volume |
76 |
| Journal issue |
8 |
| a |
16.0881 ± 0.0015 Å |
| b |
7.1958 ± 0.0008 Å |
| c |
23.177 ± 0.003 Å |
| α |
90° |
| β |
108.838 ± 0.004° |
| γ |
90° |
| Cell volume |
2539.4 ± 0.5 Å3 |
| Cell temperature |
90 ± 2 K |
| Ambient diffraction temperature |
90 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0759 |
| Residual factor for significantly intense reflections |
0.0463 |
| Weighted residual factors for significantly intense reflections |
0.103 |
| Weighted residual factors for all reflections included in the refinement |
0.1145 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.021 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2022207.html