Information card for entry 2022292
| Chemical name |
3-Cyclopropyl-5-(3-methyl-[1,2,4]triazolo[4,3-<i>a</i>]pyridin-7-yl)-1,2,4-oxadiazole |
| Formula |
C12 H11 N5 O |
| Calculated formula |
C12 H11 N5 O |
| SMILES |
o1nc(nc1c1cc2n(cc1)c(nn2)C)C1CC1 |
| Title of publication |
Conformational polymorphs of 3-cyclopropyl-5-(3-methyl-[1,2,4]triazolo[4,3-<i>a</i>]pyridin-7-yl)-1,2,4-oxadiazole |
| Authors of publication |
Shishkina, Svitlana V.; Konovalova, Irina S.; Kovalenko, Svitlana S.; Nikolaeva, Lyudmila L.; Bunyatyan, Natalya D.; Kovalenko, Sergiy M. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2021 |
| Journal volume |
77 |
| Journal issue |
1 |
| Pages of publication |
20 - 28 |
| a |
4.4041 ± 0.0004 Å |
| b |
27.8787 ± 0.0018 Å |
| c |
9.3533 ± 0.0008 Å |
| α |
90° |
| β |
100.816 ± 0.007° |
| γ |
90° |
| Cell volume |
1128 ± 0.16 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0912 |
| Residual factor for significantly intense reflections |
0.0635 |
| Weighted residual factors for significantly intense reflections |
0.1568 |
| Weighted residual factors for all reflections included in the refinement |
0.1956 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.042 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2022292.html