Information card for entry 2022323
| Chemical name |
<i>rtct</i>-1,2,3,4-Tetrakis(pyridin-4-yl)cyclobutane–4,6-dichlorobenzene-1,3-diol–water (1/1/1) |
| Formula |
C30 H26 Cl2 N4 O3 |
| Calculated formula |
C30 H26 Cl2 N4 O3 |
| SMILES |
n1ccc(C2C(C(C2c2ccncc2)c2ccncc2)c2ccncc2)cc1.Clc1cc(Cl)c(O)cc1O.O |
| Title of publication |
Honeycomb molecular network based upon a hydrate of 4,6-dichlororesorcinol and the photoproduct <i>rtct</i>-tetrakis(pyridin-4-yl)cyclobutane |
| Authors of publication |
Santana, Carlos L.; Battle, Jessica D.; Unruh, Daniel K.; Groeneman, Ryan H. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2021 |
| Journal volume |
77 |
| Journal issue |
2 |
| Pages of publication |
111 - 115 |
| a |
13.8413 ± 0.0001 Å |
| b |
8.9901 ± 0.0001 Å |
| c |
21.868 ± 0.0002 Å |
| α |
90° |
| β |
103.683 ± 0.001° |
| γ |
90° |
| Cell volume |
2643.91 ± 0.04 Å3 |
| Cell temperature |
100.2 ± 0.7 K |
| Ambient diffraction temperature |
100.2 ± 0.7 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0309 |
| Residual factor for significantly intense reflections |
0.0296 |
| Weighted residual factors for significantly intense reflections |
0.0774 |
| Weighted residual factors for all reflections included in the refinement |
0.0783 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.092 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2022323.html