Information card for entry 2022375
| Common name |
11-Azaartemisinin–4-bromosalicylic acid (1/1) |
| Chemical name |
1,5,9-Trimethyl-14,15,16-trioxa-11-azatetracyclo[10.3.1.0^4,13^.0^8,13^]hexadecan-10-one; 4-bromosalicylic acid |
| Formula |
C22 H28 Br N O7 |
| Calculated formula |
C22 H28 Br N O7 |
| SMILES |
O1[C@]23[C@H]4O[C@](O1)(CC[C@H]2[C@@H](CC[C@H]3[C@H](C(=O)N4)C)C)C.Brc1cc(c(C(=O)O)cc1)O |
| Title of publication |
Varying degrees of homostructurality in a series of cocrystals of antimalarial drug 11-azaartemisinin with salicylic acids |
| Authors of publication |
Roy, Monalisa; Li, Keyao; Nisar, Madiha; Wong, Lawrence W.-Y.; Sung, Herman H.-Y.; Haynes, Richard K.; Williams, Ian D. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2021 |
| Journal volume |
77 |
| Journal issue |
6 |
| Pages of publication |
262 - 270 |
| a |
11.0814 ± 0.0002 Å |
| b |
9.28293 ± 0.00018 Å |
| c |
11.1404 ± 0.0002 Å |
| α |
90° |
| β |
98.638 ± 0.002° |
| γ |
90° |
| Cell volume |
1132.99 ± 0.04 Å3 |
| Cell temperature |
100.01 ± 0.1 K |
| Ambient diffraction temperature |
100.01 ± 0.1 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0321 |
| Residual factor for significantly intense reflections |
0.0293 |
| Weighted residual factors for significantly intense reflections |
0.0654 |
| Weighted residual factors for all reflections included in the refinement |
0.0676 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.041 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2022375.html