Information card for entry 2022563
| Chemical name |
1,3-Diphenyl-1,2,4-benzotriazin-4(1H)-yl |
| Formula |
C19 H14 N3 |
| Calculated formula |
C19 H14 N3 |
| SMILES |
N1([N]C(=Nc2ccccc12)c1ccccc1)c1ccccc1 |
| Title of publication |
A first-order phase transition in Blatter's radical at high pressure |
| Authors of publication |
Broadhurst, Edward T.; Wilson, Cameron J. G.; Zissimou, Georgia A.; Nudelman, Fabio; Constantinides, Christos P.; Koutentis, Panayiotis A.; Parsons, Simon |
| Journal of publication |
Acta Crystallographica Section B Structural Science, Crystal Engineering and Materials |
| Year of publication |
2022 |
| Journal volume |
78 |
| Journal issue |
2 |
| a |
10.0002 ± 0.0005 Å |
| b |
6.0842 ± 0.0003 Å |
| c |
18.352 ± 0.002 Å |
| α |
90° |
| β |
100.026 ± 0.006° |
| γ |
90° |
| Cell volume |
1099.54 ± 0.14 Å3 |
| Cell temperature |
276.2 K |
| Ambient diffraction temperature |
276.2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0581 |
| Residual factor for significantly intense reflections |
0.0332 |
| Weighted residual factors for significantly intense reflections |
0.075 |
| Weighted residual factors for all reflections included in the refinement |
0.086 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.077 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2022563.html