Information card for entry 2022689
| Chemical name |
2,4,6-Trimethylpyrylium tetrafluoroborate |
| Formula |
C8 H11 B F4 O |
| Calculated formula |
C8 H11 B F4 O |
| SMILES |
[B](F)(F)(F)[F-].Cc1cc([o+]c(c1)C)C |
| Title of publication |
Quantitative insights into noncovalent interactions involving halogen and tetrel bonds in 2,4,6-trimethylpyrylium tetrafluoroborate |
| Authors of publication |
Mandal, Koushik; Sarkar, Sounak; Ghosh, Peuli; Hathwar, Venkatesha R.; Chopra, Deepak |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
2022 |
| Journal volume |
78 |
| Journal issue |
11 |
| a |
9.7906 ± 0.0005 Å |
| b |
9.6859 ± 0.0005 Å |
| c |
9.8673 ± 0.0005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
935.72 ± 0.08 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
5 |
| Space group number |
62 |
| Hermann-Mauguin space group symbol |
P n m a |
| Hall space group symbol |
-P 2ac 2n |
| Residual factor for all reflections |
0.0417 |
| Residual factor for significantly intense reflections |
0.0354 |
| Weighted residual factors for significantly intense reflections |
0.0854 |
| Weighted residual factors for all reflections included in the refinement |
0.0896 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.05 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2022689.html