Information card for entry 2022821
| Chemical name |
(<i>E</i>)-1-(2,4-Dimethylfuran-3-yl)-3-phenylprop-2-en-1-one |
| Formula |
C15 H14 O2 |
| Calculated formula |
C15 H14 O2 |
| SMILES |
o1c(C)c(c(c1)C)C(=O)/C=C/c1ccccc1 |
| Title of publication |
Crystal structure and Hirshfeld surface analysis of (E)-1-(2,4-dimethylfuran-3-yl)-3-phenylprop-2-en-1-one |
| Authors of publication |
Khalilov, Ali N.; Khrustalev, Victor N.; Samigullina, Aida I.; Akkurt, Mehmet; Rzayev, Rovnag M.; Bhattarai, Ajaya; Mamedov, İbrahim G. |
| Journal of publication |
Acta Crystallographica Section E Crystallographic Communications |
| Year of publication |
2023 |
| Journal volume |
79 |
| Journal issue |
8 |
| a |
5.84787 ± 0.00005 Å |
| b |
12.18109 ± 0.00009 Å |
| c |
16.24568 ± 0.00015 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1157.24 ± 0.017 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0302 |
| Residual factor for significantly intense reflections |
0.0299 |
| Weighted residual factors for significantly intense reflections |
0.0802 |
| Weighted residual factors for all reflections included in the refinement |
0.0806 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.058 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2022821.html