Information card for entry 2100479
| Chemical name |
S,S-1,2-dicyclohexylethane-1,2-diol |
| Formula |
C14 H26 O2 |
| Calculated formula |
C14 H26 O2 |
| SMILES |
O[C@@H](C1CCCCC1)[C@@H](O)C1CCCCC1 |
| Title of publication |
S,S-1,2-Dicyclohexylethane-1,2-diol and its racemic compound: a striking exception to Wallach's rule |
| Authors of publication |
Patrick, Brian O.; Brock, Carolyn Pratt |
| Journal of publication |
Acta Crystallographica, Section B: Structural Science |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
3 |
| Pages of publication |
488 - 497 |
| a |
5.54 ± 0.001 Å |
| b |
41.653 ± 0.006 Å |
| c |
12.025 ± 0.002 Å |
| α |
90° |
| β |
90.33 ± 0.01° |
| γ |
90° |
| Cell volume |
2774.8 ± 0.8 Å3 |
| Cell temperature |
295 ± 1 K |
| Ambient diffraction temperature |
295 ± 1 K |
| Number of distinct elements |
3 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.084 |
| Residual factor for significantly intense reflections |
0.056 |
| Weighted residual factors for significantly intense reflections |
0.13 |
| Weighted residual factors for all reflections included in the refinement |
0.144 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.09 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2100479.html