Information card for entry 2101374
| Formula |
C9 H9 Cl3 |
| Calculated formula |
C9 H9 Cl3 |
| SMILES |
Cc1c(Cl)c(C)c(c(c1Cl)C)Cl |
| Title of publication |
Structure of 1,3,5-trichloro-2,4,6-trimethylbenzene at 150 and 297 K, molecular motion and reorientation |
| Authors of publication |
Tazi, M.; Meinnel, J.; Sanquer, M.; Nusimovici, M.; Tonnard, F.; Carrie, R. |
| Journal of publication |
Acta Crystallographica Section B |
| Year of publication |
1995 |
| Journal volume |
51 |
| Journal issue |
5 |
| Pages of publication |
838 - 847 |
| a |
7.646 ± 0.003 Å |
| b |
8.789 ± 0.006 Å |
| c |
8.827 ± 0.003 Å |
| α |
59.78 ± 0.04° |
| β |
66.03 ± 0.03° |
| γ |
72.69 ± 0.04° |
| Cell volume |
465.1 ± 0.4 Å3 |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
Mo |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2101374.html