Information card for entry 2103153
| Chemical name |
6-hydroxy-4,4,5,7,8-pentamethyl-3,4-dihydrocoumarin |
| Formula |
C14 H18 O3 |
| Calculated formula |
C14 H18 O3 |
| SMILES |
O1C(=O)CC(C)(C)c2c(C)c(O)c(C)c(C)c12 |
| Title of publication |
Coupling of the lactone-ring conformation with crystal symmetry in 6-hydroxy-4,4,5,7,8-pentamethyl-3,4-dihydrocoumarin |
| Authors of publication |
Budzianowski, Armand; Katrusiak, Andrzej |
| Journal of publication |
Acta Crystallographica Section B |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
1 |
| Pages of publication |
125 - 133 |
| a |
13.345 ± 0.002 Å |
| b |
6.853 ± 0.001 Å |
| c |
13.973 ± 0.003 Å |
| α |
90° |
| β |
91.25 ± 0.02° |
| γ |
90° |
| Cell volume |
1277.6 ± 0.4 Å3 |
| Cell temperature |
220 ± 0.1 K |
| Ambient diffraction temperature |
220 ± 0.1 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0791 |
| Residual factor for significantly intense reflections |
0.055 |
| Weighted residual factors for significantly intense reflections |
0.1526 |
| Weighted residual factors for all reflections included in the refinement |
0.1707 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.996 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2103153.html