Information card for entry 2103321
| Common name |
polypodine B hydrate |
| Chemical name |
2β,3β,5β,14α,20R,22R,25-heptahydroxy-5β-cholest-7-en-6-one hydrate |
| Formula |
C27 H46 O9 |
| Calculated formula |
C27 H46 O9 |
| SMILES |
O.O[C@H]1C[C@]2([C@@](O)(C[C@H]1O)C(=O)C=C1[C@@H]2CC[C@]2([C@@]1(O)CC[C@@H]2[C@](O)(C)[C@H](O)CCC(O)(C)C)C)C |
| Title of publication |
Crystal structures of ecdysteroids: the role of solvent molecules in hydrogen bonding and isostructurality |
| Authors of publication |
Fábián, László; Argay, Gyula; Kálmán, Alajos; Báthori, Mária |
| Journal of publication |
Acta Crystallographica Section B |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
4 |
| Pages of publication |
710 - 720 |
| a |
7.163 ± 0.001 Å |
| b |
10.303 ± 0.001 Å |
| c |
37.254 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2749.4 ± 0.5 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.044 |
| Residual factor for significantly intense reflections |
0.0362 |
| Weighted residual factors for significantly intense reflections |
0.1004 |
| Weighted residual factors for all reflections included in the refinement |
0.1042 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.065 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2103321.html