Information card for entry 2103554
| Formula |
C15 H22 O9 |
| Calculated formula |
C15 H22 O9 |
| SMILES |
[C@]12([C@H]([C@]3(O[C@@]([C@](O1)(C)OC)([C@@](O2)(O3)C)C(=O)OC)C)C(=O)OC)C.[C@@]12([C@@H]([C@@]3(O[C@]([C@@](O1)(C)OC)([C@](O2)(O3)C)C(=O)OC)C)C(=O)OC)C |
| Title of publication |
Synthesis and structure of, and bonding in some derivatives of 2,6,9,10-tetraoxatricyclo[3.3.1.1^3,8^]decane |
| Authors of publication |
Simons, J.; Thomas, H. G.; Hall, S. R.; Raabe, G. |
| Journal of publication |
Acta Crystallographica Section B |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
1 |
| Pages of publication |
63 - 71 |
| a |
10.858 ± 0.003 Å |
| b |
14.117 ± 0.0008 Å |
| c |
11.519 ± 0.004 Å |
| α |
90° |
| β |
104.508 ± 0.01° |
| γ |
90° |
| Cell volume |
1709.4 ± 0.8 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.049 |
| Residual factor for significantly intense reflections |
0.049 |
| Weighted residual factors for all reflections |
0.064 |
| Weighted residual factors for all reflections included in the refinement |
0.064 |
| Goodness-of-fit parameter for all reflections |
1.002 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.002 |
| Diffraction radiation wavelength |
1.54179 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2103554.html