Information card for entry 2104353
| Common name |
Hantzsch 1,4-dihydropyridine ester |
| Chemical name |
diethyl-2,6-dimethyl-1,4 dihydro-4-(3-nitrophenyl)-3,5-pyridine dicarboxylate |
| Formula |
C19 H22 N2 O6 |
| Calculated formula |
C19 H22 N2 O6 |
| SMILES |
O=C(OCC)C1=C(NC(=C(C1c1cc(N(=O)=O)ccc1)C(=O)OCC)C)C |
| Title of publication |
Hantzsch 1,4-dihydropyridine esters and analogs: candidates for generating reproducible one-dimensional packing motifs |
| Authors of publication |
Rathore, R. S.; Reddy, B. Palakshi; Vijayakumar, V.; Ragavan, R. Venkat; Narasimhamurthy, T. |
| Journal of publication |
Acta Crystallographica Section B |
| Year of publication |
2009 |
| Journal volume |
65 |
| Journal issue |
3 |
| Pages of publication |
375 - 381 |
| a |
14.3479 ± 0.001 Å |
| b |
15.2867 ± 0.0011 Å |
| c |
8.6765 ± 0.0006 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1903 ± 0.2 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0635 |
| Residual factor for significantly intense reflections |
0.0454 |
| Weighted residual factors for significantly intense reflections |
0.0984 |
| Weighted residual factors for all reflections included in the refinement |
0.1072 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.111 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2104353.html