Information card for entry 2108884
| Formula |
C6 H9 N3 O2 |
| Calculated formula |
C6 H9 N3 O2 |
| SMILES |
O=C([O-])[C@@H]([NH3+])Cc1nc[nH]c1 |
| Title of publication |
Accurate H-atom parameters for the two polymorphs of <small>L</small>-histidine at 5, 105 and 295K |
| Authors of publication |
Novelli, Giulia; McMonagle, Charles J.; Kleemiss, Florian; Probert, Michael; Puschmann, Horst; Grabowsky, Simon; Maynard-Casely, Helen E.; McIntyre, Garry J.; Parsons, Simon |
| Journal of publication |
Acta Crystallographica Section B |
| Year of publication |
2021 |
| Journal volume |
77 |
| Journal issue |
5 |
| a |
5.1854 ± 0.0008 Å |
| b |
7.3998 ± 0.001 Å |
| c |
9.4976 ± 0.0012 Å |
| α |
90° |
| β |
98.182 ± 0.01° |
| γ |
90° |
| Cell volume |
360.72 ± 0.09 Å3 |
| Cell temperature |
295 K |
| Ambient diffraction temperature |
295 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0286 |
| Residual factor for significantly intense reflections |
0.0247 |
| Weighted residual factors for significantly intense reflections |
0.0475 |
| Weighted residual factors for all reflections included in the refinement |
0.0486 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.3485 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2108884.html