Information card for entry 2200146
| Chemical name |
(E)-1-Benzyl-2-(p-methoxystyryl)-3-(p-tolyl)-1,2,3,4-tetrahydroquinazolin-4-one |
| Formula |
C31 H28 N2 O2 |
| Calculated formula |
C31 H28 N2 O2 |
| SMILES |
O=C1N(C(N(c2c1cccc2)Cc1ccccc1)\C=C\c1ccc(OC)cc1)c1ccc(C)cc1 |
| Title of publication |
(<i>E</i>)-1-Benzyl-2-(<i>p</i>-methoxystyryl)-3-(<i>p</i>-tolyl)-1,2,3,4-tetrahydroquinazolin-4-one |
| Authors of publication |
Mukherjee, Monika; Maiti, Susim; Chaudhuri, Gopeswar; Helliwell, Madeleine; Kundu, Nitya G. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
3 |
| Pages of publication |
o247 - o249 |
| a |
13.281 ± 0.003 Å |
| b |
11.161 ± 0.002 Å |
| c |
17.756 ± 0.003 Å |
| α |
90° |
| β |
107.49 ± 0.01° |
| γ |
90° |
| Cell volume |
2510.3 ± 0.9 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.078 |
| Residual factor for significantly intense reflections |
0.047 |
| Weighted residual factors for all reflections included in the refinement |
0.182 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.04 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2200146.html