Information card for entry 2200176
| Chemical name |
3,7,7-Trimethyl-4-(β-naphthyl)-4,7,8,9-tetrahydro-2H-pyrazolo[3,4-b]- quinolin-5(6H)-one |
| Formula |
C23 H23 N3 O |
| Calculated formula |
C23 H23 N3 O |
| SMILES |
n1[nH]c(C)c2C(c3cc4ccccc4cc3)C3=C(CC(CC3=O)(C)C)Nc12 |
| Title of publication |
3,7,7-Trimethyl-4-(β-naphthyl)-4,7,8,9-tetrahydro-2<i>H</i>-pyrazolo[3,4-<i>b</i>]quinolin-5(6<i>H</i>)-one |
| Authors of publication |
Cannon, Debbie; Quesada, Antonio; Quiroga, Jairo; Mejía, Diana; Insuasty, Braulio; Abonia, Rodrigo; Cobo, Justo; Nogueras, Manuel; Sánchez, Adolfo; Low, John Nicolson |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
2 |
| Pages of publication |
o160 - o162 |
| a |
9.1222 ± 0.0018 Å |
| b |
15.281 ± 0.003 Å |
| c |
14.346 ± 0.003 Å |
| α |
90° |
| β |
106.13 ± 0.03° |
| γ |
90° |
| Cell volume |
1921.1 ± 0.7 Å3 |
| Cell temperature |
150 ± 1 K |
| Ambient diffraction temperature |
150 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.086 |
| Residual factor for significantly intense reflections |
0.051 |
| Weighted residual factors for all reflections included in the refinement |
0.137 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.029 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2200176.html