Information card for entry 2200181
| Chemical name |
6-(2-Hydroxybenzoyl)-2-(4-nitrophenyl)pyrazolo[1,5-a]pyrimidine |
| Formula |
C19 H12 N4 O4 |
| Calculated formula |
C19 H12 N4 O4 |
| SMILES |
n1c(c2ccc(N(=O)=O)cc2)cc2ncc(C(=O)c3c(O)cccc3)cn12 |
| Title of publication |
6-(2-Hydroxybenzoyl)-2-(4-nitrophenyl)pyrazolo[1,5-<i>a</i>]pyrimidine |
| Authors of publication |
Cannon, Debbie; Quesada, Antonio; Quiroga, Jairo; Insuasty, Braulio; Abonia, Rodrigo; Mejía, Diana; Cobo, Justo; Nogueras, Manuel; Sánchez, Adolfo; Low, John Nicolson |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
2 |
| Pages of publication |
o182 - o184 |
| a |
5.5421 ± 0.0002 Å |
| b |
11.5858 ± 0.0005 Å |
| c |
23.8057 ± 0.0013 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1528.56 ± 0.12 Å3 |
| Cell temperature |
150 ± 1 K |
| Ambient diffraction temperature |
150 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0935 |
| Residual factor for significantly intense reflections |
0.0469 |
| Weighted residual factors for all reflections included in the refinement |
0.1243 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.066 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2200181.html