Information card for entry 2200431
| Common name |
Dichloro(2,2-diphenyl-4,4,6,6-tetrakis(3,5-dimethylpyrazol-1-yl)- cyclotriphosphazeneCobalt(II) |
| Formula |
C32 H38 Cl2 Co N11 P3 |
| Calculated formula |
C32 H38 Cl2 Co N11 P3 |
| SMILES |
[Co]12(Cl)(Cl)[n]3[n](c(cc3C)C)P3(n4nc(cc4C)C)=NP(=NP(=[N]13)([n]1[n]2c(cc1C)C)n1nc(cc1C)C)(c1ccccc1)c1ccccc1 |
| Title of publication |
Dichloro[2,2-diphenyl-4,4,6,6-tetrakis(3,5-dimethylpyrazol-1-yl)cyclotriphosphazene]cobalt(II) |
| Authors of publication |
Prabakaran, P.; Justin Thomas, K. R.; Thomas Muthiah, P.; Bocelli, G.; Righi, L. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
9 |
| Pages of publication |
m399 - m401 |
| a |
38.755 ± 0.003 Å |
| b |
9.378 ± 0.003 Å |
| c |
22.043 ± 0.002 Å |
| α |
90° |
| β |
108.19 ± 0.03° |
| γ |
90° |
| Cell volume |
7611 ± 3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.1824 |
| Residual factor for significantly intense reflections |
0.0482 |
| Weighted residual factors for all reflections included in the refinement |
0.0738 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.735 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2200431.html