Information card for entry 2200440
| Chemical name |
4,8,9,10-Tetrakis(4-chlorophenyl)-1,3-diazaadamantan-6-one |
| Formula |
C32 H24 Cl4 N2 O |
| Calculated formula |
C32 H24 Cl4 N2 O |
| SMILES |
N12CN3[C@H](c4ccc(cc4)Cl)C([C@H]1c1ccc(cc1)Cl)C(=O)C([C@@H]2c1ccc(cc1)Cl)[C@@H]3c1ccc(cc1)Cl |
| Title of publication |
4,8,9,10-Tetrakis(4-chlorophenyl)-1,3-diazaadamantan-6-one |
| Authors of publication |
Krishnakumar, R. V.; Subha Nandhini, M.; Vijayakumar, V.; Natarajan, S.; Sundaravadivelu, M.; Perumal, S.; Mostad, A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
9 |
| Pages of publication |
o860 - o862 |
| a |
6.818 ± 0.003 Å |
| b |
13.288 ± 0.004 Å |
| c |
30.67 ± 0.014 Å |
| α |
90° |
| β |
94.47 ± 0.03° |
| γ |
90° |
| Cell volume |
2770.2 ± 1.9 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.102 |
| Residual factor for significantly intense reflections |
0.061 |
| Weighted residual factors for all reflections included in the refinement |
0.149 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.16 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2200440.html