Information card for entry 2200595
| Formula |
C25 H18 Cl2 N5 O6 P3 |
| Calculated formula |
C25 H18 Cl2 N5 O6 P3 |
| SMILES |
ClP12Oc3c(cc(N(=O)=O)cc3)Cc3cc(N(=O)=O)ccc3OP(Cl)(=NP(=N2)(c2ccccc2)c2ccccc2)N=1 |
| Title of publication |
<i>cis</i>-ansa-2,4-Dichloro-2,4-[2,2'-methylenebis(4-nitrophenoxy)]-6,6-diphenylcyclo-2λ^5^,4λ^5^,6λ^5^-triphosphazatriene |
| Authors of publication |
Hökelek, Tuncer; Dal, Hakan; Kılıç, Zeynel |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2001 |
| Journal volume |
57 |
| Journal issue |
11 |
| Pages of publication |
o1063 - o1066 |
| a |
9.9482 ± 0.001 Å |
| b |
11.2184 ± 0.001 Å |
| c |
12.8536 ± 0.001 Å |
| α |
97.702 ± 0.007° |
| β |
105.515 ± 0.007° |
| γ |
94.503 ± 0.007° |
| Cell volume |
1359.9 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0919 |
| Residual factor for significantly intense reflections |
0.0666 |
| Weighted residual factors for all reflections included in the refinement |
0.2579 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.215 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2200595.html
