Information card for entry 2200902
| Formula |
C27 H35 N O7 S |
| Calculated formula |
C27 H35 N O7 S |
| SMILES |
COc1ccc(cc1)[C@@H]1OC(=C([C@H]1C(=O)N1[C@H]2[C@]3(CS1(=O)=O)CC[C@H](C2)C3(C)C)C(=O)OC(C)C)C |
| Title of publication |
(2<i>R</i>,3<i>R</i>)-2-(4-Methoxyphenyl)-3-{1-[(3a<i>S</i>)-(3aα,6α,7aα)-hexahydro-8,8-dimethyl-3<i>H</i>-3a,6-methano-2,2-dioxo-2,1-benzoisothiazolyl]carbonyl}-4-isopropoxycarbonyl-5-methyl-2,2-dihydrofuran |
| Authors of publication |
Garzino, Frédéric; Méou, Alain; Brun, Pierre; Pèpe, Gérard |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
3 |
| Pages of publication |
o310 - o311 |
| a |
12.1894 ± 0.0007 Å |
| b |
8.9921 ± 0.0003 Å |
| c |
13.0425 ± 0.0008 Å |
| α |
90° |
| β |
107.97 ± 0.01° |
| γ |
90° |
| Cell volume |
1359.83 ± 0.15 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0775 |
| Residual factor for significantly intense reflections |
0.0571 |
| Weighted residual factors for significantly intense reflections |
0.119 |
| Weighted residual factors for all reflections included in the refinement |
0.1275 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.024 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2200902.html