Information card for entry 2200921
| Chemical name |
5-[(6-Chloro-[1,3]benzothiazol-2-ylamino)-methylene]-2,2-dimethyl- [1,3]dioxane-4,6-dione |
| Formula |
C14 H11 Cl N2 O4 S |
| Calculated formula |
C14 H11 Cl N2 O4 S |
| SMILES |
s1c(NC=C2C(=O)OC(OC2=O)(C)C)nc2ccc(Cl)cc12 |
| Title of publication |
5-[(6-Chloro-[1,3]benzothiazol-2-ylamino)methylene]-2,2-dimethyl-[1,3]dioxane-4,6-dione |
| Authors of publication |
Low, John Nicolson; Cobo, Justo; Nogueras, Manuel; Sánchez, Adolfo; Hernández, Pedro; Quiroga, Jairo |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
1 |
| Pages of publication |
o57 - o58 |
| a |
5.3389 ± 0.0004 Å |
| b |
28.583 ± 0.002 Å |
| c |
9.8618 ± 0.0008 Å |
| α |
90° |
| β |
109.178 ± 0.004° |
| γ |
90° |
| Cell volume |
1421.41 ± 0.19 Å3 |
| Cell temperature |
120 ± 1 K |
| Ambient diffraction temperature |
120 ± 1 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1393 |
| Residual factor for significantly intense reflections |
0.0544 |
| Weighted residual factors for significantly intense reflections |
0.0943 |
| Weighted residual factors for all reflections included in the refinement |
0.116 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.935 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2200921.html