Information card for entry 2200996
| Formula |
C24 H36 F6 N O8 P |
| Calculated formula |
C24 H36 F6 N O8 P |
| SMILES |
c12ccccc1OCCOCCOCCOc1ccccc1OCCOCCOCCO2.[NH4+].F[P](F)(F)(F)(F)[F-] |
| Title of publication |
Ammonium 2,5,8,11,21,24,27-octaoxatricyclo[26.4.0.0^12,17^]dotriaconta-1(32),12(17),13,15,28,30-hexaene hexafluorophosphate |
| Authors of publication |
Fallon, Gary D.; Lau, Vei-Lin; Langford, Steven J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
3 |
| Pages of publication |
o321 - o323 |
| a |
10.195 ± 0.0002 Å |
| b |
10.6379 ± 0.0002 Å |
| c |
14.5447 ± 0.0003 Å |
| α |
69.371 ± 0.001° |
| β |
71.536 ± 0.001° |
| γ |
89.67 ± 0.001° |
| Cell volume |
1390.3 ± 0.05 Å3 |
| Cell temperature |
123 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for significantly intense reflections |
0.0508 |
| Weighted residual factors for all reflections included in the refinement |
0.1325 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.974 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2200996.html
