Information card for entry 2201379
| Chemical name |
1,4-Dicholoro-1,4-diphenyl-2,3-diazabuta-1,3-diene |
| Formula |
C14 H10 Cl2 N2 |
| Calculated formula |
C14 H10 Cl2 N2 |
| SMILES |
Cl/C(=N\N=C(Cl)\c1ccccc1)c1ccccc1 |
| Title of publication |
1,4-Dichloro-1,4-diphenyl-2,3-diazabuta-1,3-diene |
| Authors of publication |
Tandon, Vishnu K.; Sharon, Ashoke; Bandichhor, Rakeshawar; Maulik, Prakas R. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
8 |
| Pages of publication |
o869 - o870 |
| a |
11.501 ± 0.001 Å |
| b |
7.5319 ± 0.0007 Å |
| c |
14.958 ± 0.002 Å |
| α |
90° |
| β |
99.25 ± 0.01° |
| γ |
90° |
| Cell volume |
1278.9 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0365 |
| Residual factor for significantly intense reflections |
0.0313 |
| Weighted residual factors for significantly intense reflections |
0.086 |
| Weighted residual factors for all reflections included in the refinement |
0.0897 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.063 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2201379.html