Information card for entry 2201457
| Chemical name |
Erythro-2-piperidinyl-1,2-diphenyl ethanol |
| Formula |
C19 H23 N O |
| Calculated formula |
C19 H23 N O |
| SMILES |
O[C@H]([C@H](N1CCCCC1)c1ccccc1)c1ccccc1.O[C@@H]([C@@H](N1CCCCC1)c1ccccc1)c1ccccc1 |
| Title of publication |
<i>erythro</i>-2-Piperidinyl-1,2-diphenylethanol |
| Authors of publication |
Ocak, Nazan; Kazak, Canan; Öztürk, Sema; Zerrin, Caliskan; Arsu, Nergis; Fun, Hoong-Kun; Erdönmez, Ahmet |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
10 |
| Pages of publication |
o1119 - o1120 |
| a |
13.6624 ± 0.001 Å |
| b |
5.6452 ± 0.001 Å |
| c |
20.678 ± 0.004 Å |
| α |
90° |
| β |
93.46 ± 0.04° |
| γ |
90° |
| Cell volume |
1591.9 ± 0.4 Å3 |
| Cell temperature |
183 ± 2 K |
| Ambient diffraction temperature |
183 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0816 |
| Residual factor for significantly intense reflections |
0.0581 |
| Weighted residual factors for significantly intense reflections |
0.1273 |
| Weighted residual factors for all reflections included in the refinement |
0.1363 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.81 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2201457.html