Information card for entry 2201501
| Chemical name |
Aquatriphenyl(trifluoroacetato)tin‒2,4,6-tris(2-pyridyl)-1,3,5-triazine (1/1) |
| Formula |
C38 H29 F3 N6 O3 Sn |
| Calculated formula |
C38 H29 F3 N6 O3 Sn |
| SMILES |
[Sn](OC(=O)C(F)(F)F)([OH2])(c1ccccc1)(c1ccccc1)c1ccccc1.n1c(nc(nc1c1ncccc1)c1ncccc1)c1ncccc1 |
| Title of publication |
Aquatriphenyl(trifluoroacetato)tin‒2,4,6-tris(2-pyridyl)-1,3,5-triazine (1/1) |
| Authors of publication |
Chee, Chin Fei; Lo, Kong Mun; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
11 |
| Pages of publication |
m661 - m662 |
| a |
10.567 ± 0.001 Å |
| b |
11.053 ± 0.001 Å |
| c |
15.438 ± 0.001 Å |
| α |
105.559 ± 0.002° |
| β |
97.496 ± 0.002° |
| γ |
101.637 ± 0.002° |
| Cell volume |
1668.5 ± 0.2 Å3 |
| Cell temperature |
168 ± 2 K |
| Ambient diffraction temperature |
168 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.059 |
| Residual factor for significantly intense reflections |
0.04 |
| Weighted residual factors for significantly intense reflections |
0.092 |
| Weighted residual factors for all reflections included in the refinement |
0.095 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.93 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2201501.html