Information card for entry 2201563
| Common name |
2,4,5-trichloroacetanilide |
| Chemical name |
N-[2,4,5-trichlorophenyl]acetamide |
| Formula |
C8 H6 Cl3 N O |
| Calculated formula |
C8 H6 Cl3 N O |
| SMILES |
Clc1c(NC(=O)C)cc(Cl)c(Cl)c1 |
| Title of publication |
2,4,5-Trichloroacetanilide |
| Authors of publication |
Mahalakshmi, L.; Upadhyaya, V.; Guru Row, T. N. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
8 |
| Pages of publication |
o946 - o947 |
| a |
3.9015 ± 0.0008 Å |
| b |
12.658 ± 0.003 Å |
| c |
9.6687 ± 0.0019 Å |
| α |
90° |
| β |
101.186 ± 0.005° |
| γ |
90° |
| Cell volume |
468.42 ± 0.17 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
7 |
| Hermann-Mauguin space group symbol |
P 1 n 1 |
| Hall space group symbol |
P -2yac |
| Residual factor for all reflections |
0.0238 |
| Residual factor for significantly intense reflections |
0.0232 |
| Weighted residual factors for significantly intense reflections |
0.061 |
| Weighted residual factors for all reflections included in the refinement |
0.0616 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.049 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2201563.html