Information card for entry 2201651
| Chemical name |
2,3,4,5,6-Pentabromophenyl phenyl ether |
| Formula |
C12 H5 Br5 O |
| Calculated formula |
C12 H5 Br5 O |
| SMILES |
Brc1c(Oc2ccccc2)c(Br)c(Br)c(Br)c1Br |
| Title of publication |
2,3,4,5,6-Pentabromophenyl phenyl ether |
| Authors of publication |
Eriksson, Lars; Hu, Jiwei |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
7 |
| Pages of publication |
o794 - o796 |
| a |
11.579 ± 0.004 Å |
| b |
5.3284 ± 0.0011 Å |
| c |
24.133 ± 0.006 Å |
| α |
90° |
| β |
102.66 ± 0.03° |
| γ |
90° |
| Cell volume |
1452.7 ± 0.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0872 |
| Residual factor for significantly intense reflections |
0.036 |
| Weighted residual factors for significantly intense reflections |
0.0608 |
| Weighted residual factors for all reflections included in the refinement |
0.0662 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.031 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2201651.html