Information card for entry 2201691
| Chemical name |
N,N'-Bis[2-(2-pyridyl)methyl]pyridine-2,6-dicarboxamide hemihydrate |
| Formula |
C19 H18 N5 O2.5 |
| Calculated formula |
C19 H18 N5 O2.5 |
| SMILES |
O=C(c1cccc(n1)C(=O)NCc1ccccn1)NCc1ccccn1.O |
| Title of publication |
<i>N,N</i>'-Bis[2-(2-pyridyl)methyl]pyridine-2,6-dicarboxamide hemihydrate |
| Authors of publication |
Qi, Jian Ying; Chen, Jian; Yang, Qi Yun; Zhou, Zhong Yuan; Chan, Albert S. C. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
11 |
| Pages of publication |
o1232 - o1233 |
| a |
17.784 ± 0.003 Å |
| b |
17.611 ± 0.003 Å |
| c |
14.217 ± 0.002 Å |
| α |
90° |
| β |
126.31 ± 0.003° |
| γ |
90° |
| Cell volume |
3588.1 ± 1 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.1436 |
| Residual factor for significantly intense reflections |
0.0549 |
| Weighted residual factors for significantly intense reflections |
0.1209 |
| Weighted residual factors for all reflections included in the refinement |
0.1365 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2201691.html