Information card for entry 2201693
| Common name |
[8,8'-(Propane-1,3-diyldioxy)diquinoline-κ^4^N,O,O',N']silver(I) trifluoromethanesulfonate |
| Chemical name |
[8,8'-(Propane-1,3-diyldioxy)diquinoline-κ^4^N,O,O',N']silver(I) trifluoromethanesulfonate |
| Formula |
C22 H18 Ag F3 N2 O5 S |
| Calculated formula |
C22 H18 Ag F3 N2 O5 S |
| SMILES |
[Ag]123[n]4cccc5cccc([O]2CCC[O]3c6cccc7ccc[n]1c67)c45.S(=O)(=O)([O-])C(F)(F)F |
| Title of publication |
[8,8'-(Propane-1,3-diyldioxy)diquinoline-κ^4^<i>N,O,O</i>',<i>N</i>']silver(I) trifluoromethanesulfonate |
| Authors of publication |
An-Wu Xu; Yue-Peng Cai; Li-Zhi Zhang; Cheng-Yong Su; Bei-Sheng Kang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2002 |
| Journal volume |
58 |
| Journal issue |
12 |
| Pages of publication |
m770 - m771 |
| a |
21.9899 ± 0.0011 Å |
| b |
13.3576 ± 0.0011 Å |
| c |
15.2317 ± 0.001 Å |
| α |
90° |
| β |
103.828 ± 0.002° |
| γ |
90° |
| Cell volume |
4344.4 ± 0.5 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
7 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0569 |
| Residual factor for significantly intense reflections |
0.0432 |
| Weighted residual factors for significantly intense reflections |
0.1154 |
| Weighted residual factors for all reflections included in the refinement |
0.1225 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.034 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2201693.html