Information card for entry 2201803
| Chemical name |
(-)-(P)-N,N'-bis[(5-bromo-2-hydroxyphenyl)methylidene]- 6,6'-dimethyl-1,1'-biphenyl-2,2'-dimethanamine |
| Formula |
C30 H26 Br2 N2 O2 |
| Calculated formula |
C30 H26 Br2 N2 O2 |
| SMILES |
Brc1ccc(O)c(/C=N/Cc2c(c(ccc2)C)c2c(cccc2C)C/N=C/c2c(O)ccc(Br)c2)c1 |
| Title of publication |
({-})-(<i>P</i>)-<i>N,N</i>'-Bis[(5-bromo-2-hydroxyphenyl)methylidene]-6,6'-dimethyl-1,1'-biphenyl-2,2'-dimethanamine |
| Authors of publication |
Linden, Anthony; Rippert, Andreas J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
4 |
| Pages of publication |
o390 - o392 |
| a |
17.496 ± 0.005 Å |
| b |
18.59 ± 0.002 Å |
| c |
8.074 ± 0.007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2626 ± 2 Å3 |
| Cell temperature |
173 ± 1 K |
| Ambient diffraction temperature |
173 ± 1 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.1414 |
| Residual factor for significantly intense reflections |
0.0482 |
| Weighted residual factors for significantly intense reflections |
0.0876 |
| Weighted residual factors for all reflections included in the refinement |
0.1055 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.982 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2201803.html