Information card for entry 2201931
| Chemical name |
Tetrabutylammonium 2,6-dihydroxybenzoate 2,6-dihydroxybenzoic acid solvate |
| Formula |
C30 H47 N O8 |
| Calculated formula |
C30 H47 N O8 |
| SMILES |
[N+](CCCC)(CCCC)(CCCC)CCCC.O=C([O-])c1c(O)cccc1O.OC(=O)c1c(O)cccc1O |
| Title of publication |
Tetrabutylammonium 2,6-dihydroxybenzoate 2,6-dihydroxybenzoic acid solvate |
| Authors of publication |
Almeida Paz, Filipe A.; Soares-Santos, Paula C. R.; Nogueira, Helena I. S.; Trindade, Tito; Klinowski, Jacek |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
4 |
| Pages of publication |
o506 - o508 |
| a |
13.984 ± 0.0003 Å |
| b |
14.0507 ± 0.0002 Å |
| c |
15.4152 ± 0.0004 Å |
| α |
86.201 ± 0.006° |
| β |
84.847 ± 0.007° |
| γ |
89.898 ± 0.007° |
| Cell volume |
3009.96 ± 0.12 Å3 |
| Cell temperature |
180 ± 2 K |
| Ambient diffraction temperature |
180 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
1 |
| Hermann-Mauguin space group symbol |
P 1 |
| Hall space group symbol |
P 1 |
| Residual factor for all reflections |
0.0573 |
| Residual factor for significantly intense reflections |
0.043 |
| Weighted residual factors for significantly intense reflections |
0.1044 |
| Weighted residual factors for all reflections included in the refinement |
0.1131 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.123 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2201931.html