Information card for entry 2202678
| Chemical name |
2-Benzyl-5-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-2,3-dihydro- 1H-isoindole-1,3-dione |
| Formula |
C19 H12 N2 O4 |
| Calculated formula |
C19 H12 N2 O4 |
| SMILES |
O=C1N(C(=O)C=C1)c1ccc2C(=O)N(C(=O)c2c1)Cc1ccccc1 |
| Title of publication |
2-Benzyl-5-(2,5-dioxo-2,5-dihydro-1<i>H</i>-pyrrol-1-yl)-2,3-dihydro-1<i>H</i>-isoindole-1,3-dione |
| Authors of publication |
Shi, Da-Xin; Feng, Ya-Qing; Li, Xiao-Fang; Zhou, Li-shan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
7 |
| Pages of publication |
o1068 - o1069 |
| a |
5.061 ± 0.002 Å |
| b |
11.803 ± 0.004 Å |
| c |
14.186 ± 0.005 Å |
| α |
112.607 ± 0.006° |
| β |
94.05 ± 0.006° |
| γ |
95.755 ± 0.006° |
| Cell volume |
772.8 ± 0.5 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0549 |
| Residual factor for significantly intense reflections |
0.0377 |
| Weighted residual factors for all reflections included in the refinement |
0.1149 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.06 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2202678.html