Information card for entry 2202724
| Chemical name |
1,2-Dimethyl-1,2-bis(2,3,4-triphenyl-1-naphthyl)disiloxane hexane solvate |
| Formula |
C64 H60 O Si2 |
| Calculated formula |
C58 H46 O Si2 |
| SMILES |
[SiH](C)(O[SiH](C)c1c(c(c(c2ccccc12)c1ccccc1)c1ccccc1)c1ccccc1)c1c(c(c(c2ccccc12)c1ccccc1)c1ccccc1)c1ccccc1 |
| Title of publication |
1,3-Dimethyl-1,3-bis(2,3,4-triphenyl-1-naphthyl)disiloxane hexane solvate |
| Authors of publication |
Müller, Thomas; Meyer, Rita; Bolte, Michael |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
11 |
| Pages of publication |
o1838 - o1839 |
| a |
18.716 ± 0.004 Å |
| b |
15.533 ± 0.003 Å |
| c |
17.685 ± 0.004 Å |
| α |
90° |
| β |
96.67 ± 0.02° |
| γ |
90° |
| Cell volume |
5106.5 ± 1.9 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.3488 |
| Residual factor for significantly intense reflections |
0.1341 |
| Weighted residual factors for significantly intense reflections |
0.2808 |
| Weighted residual factors for all reflections included in the refinement |
0.3625 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.967 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2202724.html