Information card for entry 2202794
| Chemical name |
1,3-Bis(4-fluorobenzenesulfonyl)-5-methylene-1,2,3,4,5,6-hexahydropyrimidine |
| Formula |
C17 H16 F2 N2 O4 S2 |
| Calculated formula |
C17 H16 F2 N2 O4 S2 |
| SMILES |
S(=O)(=O)(N1CN(S(=O)(=O)c2ccc(F)cc2)CC(=C)C1)c1ccc(cc1)F |
| Title of publication |
1,3-Bis(4-fluorobenzenesulfonyl)-5-methylene-1,2,3,4,5,6-hexahydropyrimidine |
| Authors of publication |
Gilardi, Richard; Dave, Paritosh R; Evans, Robin N. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2003 |
| Journal volume |
59 |
| Journal issue |
9 |
| Pages of publication |
o1286 - o1287 |
| a |
13.8591 ± 0.0002 Å |
| b |
10.8218 ± 0.0001 Å |
| c |
13.8946 ± 0.0002 Å |
| α |
90° |
| β |
114.751 ± 0.001° |
| γ |
90° |
| Cell volume |
1892.48 ± 0.05 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0482 |
| Residual factor for significantly intense reflections |
0.0446 |
| Weighted residual factors for significantly intense reflections |
0.1201 |
| Weighted residual factors for all reflections included in the refinement |
0.1241 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.068 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2202794.html