Information card for entry 2203133
| Common name |
4,5-diiodo[1,2,5]thiadiazolotetrathiafulvalene |
| Chemical name |
5-(4,5-diiodo-1,3-dithiol-2-ylidene)-1,3,2,4,6-diazatrithiapentalene |
| Formula |
C6 I2 N2 S5 |
| Calculated formula |
C6 I2 N2 S5 |
| SMILES |
IC1=C(I)SC(S1)=C1Sc2nsnc2S1 |
| Title of publication |
4,5-Diiodo[1,2,5]thiadiazolotetrathiafulvalene |
| Authors of publication |
Tomura, Masaaki; Yamashita, Yoshiro |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2004 |
| Journal volume |
60 |
| Journal issue |
1 |
| Pages of publication |
o63 - o65 |
| a |
12.18 ± 0.005 Å |
| b |
4.8825 ± 0.0017 Å |
| c |
20.083 ± 0.008 Å |
| α |
90° |
| β |
91.152 ± 0.009° |
| γ |
90° |
| Cell volume |
1194.1 ± 0.8 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.123 |
| Residual factor for significantly intense reflections |
0.099 |
| Weighted residual factors for significantly intense reflections |
0.18 |
| Weighted residual factors for all reflections included in the refinement |
0.189 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.31 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2203133.html